C18H18 — CID 143808839
1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-hexa-1,3,5-trien-2-yl]benzene (PubChem CID 143808839) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-hexa-1,3,5-trien-2-yl]benzene.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-hexa-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 143808839 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-hexa-1,3,5-trien-2-yl]benzene |
| SMILES | C=C/C=C\C(=C)c1cccc(C2=CCCC=C2)c1 |
| InChI | InChI=1S/C18H18/c1-3-4-9-15(2)17-12-8-13-18(14-17)16-10-6-5-7-11-16/h3-4,6,8-14H,1-2,5,7H2/b9-4- |
| InChIKey | QYYRKRCWXVBRHG-WTKPLQERSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|