C19H25N — CID 138518273
3-cyclohexa-1,5-dien-1-yl-N-ethyl-N-pent-4-en-2-ylaniline (PubChem CID 138518273) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-N-ethyl-N-pent-4-en-2-ylaniline.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-N-ethyl-N-pent-4-en-2-ylaniline |
|---|---|
| PubChem CID | 138518273 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-N-ethyl-N-pent-4-en-2-ylaniline |
| SMILES | C=CCC(C)N(CC)c1cccc(C2=CCCC=C2)c1 |
| InChI | InChI=1S/C19H25N/c1-4-10-16(3)20(5-2)19-14-9-13-18(15-19)17-11-7-6-8-12-17/h4,7,9,11-16H,1,5-6,8,10H2,2-3H3 |
| InChIKey | REFRXYYBDBCPSR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|