C13H16FN — CID 144557554
fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline (PubChem CID 144557554) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline.
| Compound Name | fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline |
|---|---|
| PubChem CID | 144557554 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline |
| SMILES | C=C/C=C\C(=C)c1cccc(N)c1.CF |
| InChI | InChI=1S/C12H13N.CH3F/c1-3-4-6-10(2)11-7-5-8-12(13)9-11;1-2/h3-9H,1-2,13H2;1H3/b6-4-; |
| InChIKey | XXXGAWZCBBHFGG-YHSAGPEESA-N |
| XLogP | 3.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|