About fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline
fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline (PubChem CID 144557554) has the molecular formula C13H16FN
and a molecular weight of 205.28 g/mol. Its IUPAC name is fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline.
Molecular Properties
| Compound Name | fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline |
| PubChem CID | 144557554 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline |
| SMILES | C=C/C=C\C(=C)c1cccc(N)c1.CF |
| InChI | InChI=1S/C12H13N.CH3F/c1-3-4-6-10(2)11-7-5-8-12(13)9-11;1-2/h3-9H,1-2,13H2;1H3/b6-4-; |
| InChIKey | XXXGAWZCBBHFGG-YHSAGPEESA-N |
| XLogP | 3.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline?
The IUPAC name of fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline (CID 144557554) is fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline.
What is the SMILES notation for fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline?
The canonical SMILES for fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline is C=C/C=C\C(=C)c1cccc(N)c1.CF.
What is the InChIKey of fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline?
The InChIKey is XXXGAWZCBBHFGG-YHSAGPEESA-N. The full InChI is InChI=1S/C12H13N.CH3F/c1-3-4-6-10(2)11-7-5-8-12(13)9-11;1-2/h3-9H,1-2,13H2;1H3/b6-4-;.
What are the key properties of fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline?
fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline has a molecular weight of 205.28 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]aniline is sourced from PubChem (CID 144557554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).