About 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline
3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline (PubChem CID 21392403) has the molecular formula C8H6ClF2N
and a molecular weight of 189.59 g/mol. Its IUPAC name is 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline.
Molecular Properties
| Compound Name | 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline |
| PubChem CID | 21392403 |
| Molecular Formula | C8H6ClF2N |
| Molecular Weight | 189.59 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline |
| SMILES | Nc1cccc(/C(F)=C(\F)Cl)c1 |
| InChI | InChI=1S/C8H6ClF2N/c9-8(11)7(10)5-2-1-3-6(12)4-5/h1-4H,12H2/b8-7+ |
| InChIKey | HPJHTKRAUUDEPC-BQYQJAHWSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline?
The IUPAC name of 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline (CID 21392403) is 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline.
What is the SMILES notation for 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline?
The canonical SMILES for 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline is Nc1cccc(/C(F)=C(\F)Cl)c1.
What is the InChIKey of 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline?
The InChIKey is HPJHTKRAUUDEPC-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H6ClF2N/c9-8(11)7(10)5-2-1-3-6(12)4-5/h1-4H,12H2/b8-7+.
What are the key properties of 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline?
3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline has a molecular weight of 189.59 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-chloro-1,2-difluoroethenyl]aniline is sourced from PubChem (CID 21392403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).