C8H7Cl2NO — CID 45081008
1-(3-aminophenyl)-2,2-dichloroethanone (PubChem CID 45081008) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2,2-dichloroethanone.
| Compound Name | 1-(3-aminophenyl)-2,2-dichloroethanone |
|---|---|
| PubChem CID | 45081008 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 1-(3-aminophenyl)-2,2-dichloroethanone |
| SMILES | Nc1cccc(C(=O)C(Cl)Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO/c9-8(10)7(12)5-2-1-3-6(11)4-5/h1-4,8H,11H2 |
| InChIKey | JRRYMSJCAVMOKR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|