C16H19NS — CID 143844903
3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]aniline (PubChem CID 143844903) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is 3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]aniline.
| Compound Name | 3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]aniline |
|---|---|
| PubChem CID | 143844903 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]aniline |
| SMILES | C=C/C=C(C)\C(=C/C)SC(=C)c1cccc(N)c1 |
| InChI | InChI=1S/C16H19NS/c1-5-8-12(3)16(6-2)18-13(4)14-9-7-10-15(17)11-14/h5-11H,1,4,17H2,2-3H3/b12-8-,16-6+ |
| InChIKey | WNYAUMWBYSFCGR-OROMQGRASA-N |
| XLogP | 5.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|