C27H35NOS — CID 143845078
ethane;N-[3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]phenyl]acetamide;toluene (PubChem CID 143845078) has the molecular formula C27H35NOS and a molecular weight of 421.65 g/mol. Its IUPAC name is ethane;N-[3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]phenyl]acetamide;toluene.
| Compound Name | ethane;N-[3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]phenyl]acetamide;toluene |
|---|---|
| PubChem CID | 143845078 |
| Molecular Formula | C27H35NOS |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | ethane;N-[3-[1-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]sulfanylethenyl]phenyl]acetamide;toluene |
| SMILES | C=C/C=C(C)\C(=C/C)SC(=C)c1cccc(NC(C)=O)c1.CC.Cc1ccccc1 |
| InChI | InChI=1S/C18H21NOS.C7H8.C2H6/c1-6-9-13(3)18(7-2)21-14(4)16-10-8-11-17(12-16)19-15(5)20;1-7-5-3-2-4-6-7;1-2/h6-12H,1,4H2,2-3,5H3,(H,19,20);2-6H,1H3;1-2H3/b13-9-,18-7+;; |
| InChIKey | PJPSSNDYPRLBAS-MBMATIBXSA-N |
| XLogP | 8.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|