C17H20S — CID 143844986
1-methyl-3-[1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]sulfanylethenyl]benzene (PubChem CID 143844986) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is 1-methyl-3-[1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]sulfanylethenyl]benzene.
| Compound Name | 1-methyl-3-[1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]sulfanylethenyl]benzene |
|---|---|
| PubChem CID | 143844986 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-methyl-3-[1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]sulfanylethenyl]benzene |
| SMILES | C=C(SC(=C)c1cccc(C)c1)/C(C)=C\C=C/C |
| InChI | InChI=1S/C17H20S/c1-6-7-10-14(3)15(4)18-16(5)17-11-8-9-13(2)12-17/h6-12H,4-5H2,1-3H3/b7-6-,14-10- |
| InChIKey | IUVDCZGZMNRVSS-FSGUHFLXSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|