C20H32 — CID 143291684
ethane;1-methyl-3-[(2E,4E)-7-methylocta-2,4,6-trien-4-yl]benzene (PubChem CID 143291684) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is ethane;1-methyl-3-[(2E,4E)-7-methylocta-2,4,6-trien-4-yl]benzene.
| Compound Name | ethane;1-methyl-3-[(2E,4E)-7-methylocta-2,4,6-trien-4-yl]benzene |
|---|---|
| PubChem CID | 143291684 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | ethane;1-methyl-3-[(2E,4E)-7-methylocta-2,4,6-trien-4-yl]benzene |
| SMILES | C/C=C/C(=C\C=C(C)C)c1cccc(C)c1.CC.CC |
| InChI | InChI=1S/C16H20.2C2H6/c1-5-7-15(11-10-13(2)3)16-9-6-8-14(4)12-16;2*1-2/h5-12H,1-4H3;2*1-2H3/b7-5+,15-11+;; |
| InChIKey | DSGOSYDLJZZBOH-ODIHGUSISA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|