C19H20 — CID 144938700
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]benzene (PubChem CID 144938700) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]benzene.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]benzene |
|---|---|
| PubChem CID | 144938700 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]benzene |
| SMILES | C=C/C=C(\C=C)c1cccc(C(/C=C\C)=C/C=C)c1 |
| InChI | InChI=1S/C19H20/c1-5-10-16(8-4)18-13-9-14-19(15-18)17(11-6-2)12-7-3/h5-15H,1-2,4H2,3H3/b12-7-,16-10+,17-11+ |
| InChIKey | USLOXMAWHUOEOJ-WMYANDRUSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|