C28H29N3 — CID 144989732
3-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-(methylideneamino)methylidene]-N'-methylbenzenecarboximidamide (PubChem CID 144989732) has the molecular formula C28H29N3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-(methylideneamino)methylidene]-N'-methylbenzenecarboximidamide.
| Compound Name | 3-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-(methylideneamino)methylidene]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144989732 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 3-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-(methylideneamino)methylidene]-N'-methylbenzenecarboximidamide |
| SMILES | C=C/C=C(\C=C)c1cccc(/C(N=C)=N/C(=N\C)c2cccc(C(/C=C\C)=C/C)c2)c1 |
| InChI | InChI=1S/C28H29N3/c1-7-13-21(9-3)23-15-11-17-25(19-23)27(29-5)31-28(30-6)26-18-12-16-24(20-26)22(10-4)14-8-2/h7-20H,1,3,5H2,2,4,6H3/b14-8-,21-13+,22-10+,30-28-,31-27- |
| InChIKey | MDRRFWFLAOQFGX-PQTQFUQVSA-N |
| XLogP | 6.95 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|