C39H38 — CID 168994151
ethane;9-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-10-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]anthracene (PubChem CID 168994151) has the molecular formula C39H38 and a molecular weight of 506.73 g/mol. Its IUPAC name is ethane;9-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-10-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]anthracene.
| Compound Name | ethane;9-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-10-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]anthracene |
|---|---|
| PubChem CID | 168994151 |
| Molecular Formula | C39H38 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | ethane;9-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-10-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]anthracene |
| SMILES | C=C/C(=C\C)c1ccc(-c2c3ccccc3c(-c3cccc(C(/C=C\C)=C/C)c3)c3ccccc23)cc1.CC |
| InChI | InChI=1S/C37H32.C2H6/c1-5-14-27(8-4)30-15-13-16-31(25-30)37-34-19-11-9-17-32(34)36(33-18-10-12-20-35(33)37)29-23-21-28(22-24-29)26(6-2)7-3;1-2/h5-25H,2H2,1,3-4H3;1-2H3/b14-5-,26-7+,27-8+; |
| InChIKey | NRGSHOIVHVZTST-DXDNWFHRSA-N |
| XLogP | 11.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|