C48H35N3 — CID 130461932
N-[(1E,3Z)-2-[3-[6-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]pyrimidin-4-yl]phenyl]penta-1,3-dienyl]methanimine (PubChem CID 130461932) has the molecular formula C48H35N3 and a molecular weight of 653.83 g/mol. Its IUPAC name is N-[(1E,3Z)-2-[3-[6-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]pyrimidin-4-yl]phenyl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-[3-[6-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]pyrimidin-4-yl]phenyl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 130461932 |
| Molecular Formula | C48H35N3 |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | N-[(1E,3Z)-2-[3-[6-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]pyrimidin-4-yl]phenyl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)c1cccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4c5ccccc5c(-c5ccccc5)c5ccccc45)cc3)n2)c1 |
| InChI | InChI=1S/C48H35N3/c1-3-15-39(32-49-2)37-20-14-21-38(30-37)45-31-44(33-16-6-4-7-17-33)50-48(51-45)36-28-26-35(27-29-36)47-42-24-12-10-22-40(42)46(34-18-8-5-9-19-34)41-23-11-13-25-43(41)47/h3-32H,2H2,1H3/b15-3-,39-32+ |
| InChIKey | HFMDOKVRQCLAAY-NTINTYPHSA-N |
| XLogP | 12.74 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|