C64H50N4 — CID 130392520
4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-phenyl-6-[4-[1-phenyl-1-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]ethyl]phenyl]pyrimidine (PubChem CID 130392520) has the molecular formula C64H50N4 and a molecular weight of 875.13 g/mol. Its IUPAC name is 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-phenyl-6-[4-[1-phenyl-1-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]ethyl]phenyl]pyrimidine.
| Compound Name | 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-phenyl-6-[4-[1-phenyl-1-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]ethyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 130392520 |
| Molecular Formula | C64H50N4 |
| Molecular Weight | 875.13 g/mol |
| Exact Mass | 874.40 |
| IUPAC Name | 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-phenyl-6-[4-[1-phenyl-1-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]ethyl]phenyl]pyrimidine |
| SMILES | C/C=C\C(=C/C)c1ccc(-c2cc(-c3ccc(C(C)(c4ccccc4)c4ccc(-c5cc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccccc6)n5)cc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C64H50N4/c1-4-18-45(5-2)47-27-31-49(32-28-47)58-43-60(67-62(65-58)53-21-12-7-13-22-53)51-35-39-56(40-36-51)64(3,55-25-16-9-17-26-55)57-41-37-52(38-42-57)61-44-59(66-63(68-61)54-23-14-8-15-24-54)50-33-29-48(30-34-50)46-19-10-6-11-20-46/h4-44H,1-3H3/b18-4-,45-5+ |
| InChIKey | ZKTIPLXZUQDYKM-QSMDYDFBSA-N |
| XLogP | 16.27 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.13 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|