C20H25NS — CID 145144742
ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylsulfanyl-6-phenylpyridine (PubChem CID 145144742) has the molecular formula C20H25NS and a molecular weight of 311.49 g/mol. Its IUPAC name is ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylsulfanyl-6-phenylpyridine.
| Compound Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylsulfanyl-6-phenylpyridine |
|---|---|
| PubChem CID | 145144742 |
| Molecular Formula | C20H25NS |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylsulfanyl-6-phenylpyridine |
| SMILES | C/C=C\C(=C/C)c1cc(SC)nc(-c2ccccc2)c1.CC |
| InChI | InChI=1S/C18H19NS.C2H6/c1-4-9-14(5-2)16-12-17(19-18(13-16)20-3)15-10-7-6-8-11-15;1-2/h4-13H,1-3H3;1-2H3/b9-4-,14-5+; |
| InChIKey | NBRIWVBEQHJXCR-YOAJXEBBSA-N |
| XLogP | 6.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|