C16H16BN3O2 — CID 144781895
[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]-N-oxoboronamidic acid (PubChem CID 144781895) has the molecular formula C16H16BN3O2 and a molecular weight of 293.14 g/mol. Its IUPAC name is [2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]-N-oxoboronamidic acid.
| Compound Name | [2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]-N-oxoboronamidic acid |
|---|---|
| PubChem CID | 144781895 |
| Molecular Formula | C16H16BN3O2 |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]-N-oxoboronamidic acid |
| SMILES | C/C=C\C(=C/C)c1nc(B(O)N=O)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H16BN3O2/c1-3-8-12(4-2)16-18-14(13-9-6-5-7-10-13)11-15(19-16)17(21)20-22/h3-11,21H,1-2H3/b8-3-,12-4+ |
| InChIKey | VVPIIISHXSEKJZ-KNZHWYAJSA-N |
| XLogP | 2.58 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|