C45H32F2N4 — CID 135247117
4-[9,9-difluoro-6-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]fluoren-3-yl]-2,6-diphenylpyrimidine (PubChem CID 135247117) has the molecular formula C45H32F2N4 and a molecular weight of 666.78 g/mol. Its IUPAC name is 4-[9,9-difluoro-6-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]fluoren-3-yl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[9,9-difluoro-6-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]fluoren-3-yl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 135247117 |
| Molecular Formula | C45H32F2N4 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | 4-[9,9-difluoro-6-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]fluoren-3-yl]-2,6-diphenylpyrimidine |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)cc(-c2ccc3c(c2)-c2cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)ccc2C3(F)F)n1 |
| InChI | InChI=1S/C45H32F2N4/c1-3-14-29(4-2)43-48-39(30-15-8-5-9-16-30)27-41(50-43)33-21-23-37-35(25-33)36-26-34(22-24-38(36)45(37,46)47)42-28-40(31-17-10-6-11-18-31)49-44(51-42)32-19-12-7-13-20-32/h3-28H,1-2H3/b14-3-,29-4+ |
| InChIKey | BHGDKBMALICOKL-JILOUWAJSA-N |
| XLogP | 11.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|