C34H21F2N3 — CID 134271802
2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenylpyrimidine (PubChem CID 134271802) has the molecular formula C34H21F2N3 and a molecular weight of 509.56 g/mol. Its IUPAC name is 2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenylpyrimidine.
| Compound Name | 2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 134271802 |
| Molecular Formula | C34H21F2N3 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenylpyrimidine |
| SMILES | FC1(F)c2ccc(-c3ccncc3)cc2-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C34H21F2N3/c35-34(36)29-13-11-25(22-15-17-37-18-16-22)19-27(29)28-20-26(12-14-30(28)34)33-38-31(23-7-3-1-4-8-23)21-32(39-33)24-9-5-2-6-10-24/h1-21H |
| InChIKey | JUENYHKGRAGYBM-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |