C59H38F2N2 — CID 134271771
2-[4-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]phenyl]-4,6-diphenylpyridine (PubChem CID 134271771) has the molecular formula C59H38F2N2 and a molecular weight of 812.96 g/mol. Its IUPAC name is 2-[4-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]phenyl]-4,6-diphenylpyridine.
| Compound Name | 2-[4-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]phenyl]-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 134271771 |
| Molecular Formula | C59H38F2N2 |
| Molecular Weight | 812.96 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | 2-[4-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]phenyl]-4,6-diphenylpyridine |
| SMILES | FC1(F)c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)cc3)cc2-c2cc(-c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)ccc21 |
| InChI | InChI=1S/C59H38F2N2/c60-59(61)53-31-29-47(40-21-23-42(24-22-40)50-37-56(44-17-9-3-10-18-44)62-57(38-50)45-19-11-4-12-20-45)33-51(53)52-34-48(30-32-54(52)59)41-25-27-46(28-26-41)58-36-49(39-13-5-1-6-14-39)35-55(63-58)43-15-7-2-8-16-43/h1-38H |
| InChIKey | JGKYIPCYABEEBT-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.96 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |