C57H38F2N4 — CID 145277075
2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-difluoro-7,8-dihydrofluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 145277075) has the molecular formula C57H38F2N4 and a molecular weight of 816.96 g/mol. Its IUPAC name is 2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-difluoro-7,8-dihydrofluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-difluoro-7,8-dihydrofluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145277075 |
| Molecular Formula | C57H38F2N4 |
| Molecular Weight | 816.96 g/mol |
| Exact Mass | 816.31 |
| IUPAC Name | 2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-difluoro-7,8-dihydrofluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC1(F)C2=C(C=C(c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)CC2)c2cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)ccc21 |
| InChI | InChI=1S/C57H38F2N4/c58-57(59)50-31-29-45(38-21-25-41(26-22-38)53-36-47(37-13-5-1-6-14-37)35-52(60-53)40-15-7-2-8-16-40)33-48(50)49-34-46(30-32-51(49)57)39-23-27-44(28-24-39)56-62-54(42-17-9-3-10-18-42)61-55(63-56)43-19-11-4-12-20-43/h1-28,30,32-36H,29,31H2 |
| InChIKey | ACIKPSMSZUYADN-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.96 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |