C59H40N2 — CID 130439847
2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyridine (PubChem CID 130439847) has the molecular formula C59H40N2 and a molecular weight of 776.98 g/mol. Its IUPAC name is 2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyridine.
| Compound Name | 2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 130439847 |
| Molecular Formula | C59H40N2 |
| Molecular Weight | 776.98 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | 2-[4-[6-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)-c4cc(-c6ccc(-c7cc(-c8ccccc8)cc(-c8ccccc8)n7)cc6)ccc4C5)cc3)c2)cc1 |
| InChI | InChI=1S/C59H40N2/c1-5-13-40(14-6-1)52-36-56(44-17-9-3-10-18-44)60-58(38-52)46-25-21-42(22-26-46)48-29-31-50-33-51-32-30-49(35-55(51)54(50)34-48)43-23-27-47(28-24-43)59-39-53(41-15-7-2-8-16-41)37-57(61-59)45-19-11-4-12-20-45/h1-32,34-39H,33H2 |
| InChIKey | VETZPJHCEWJGAQ-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.98 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |