C59H42F2N2 — CID 135247145
2-[(2E,4Z)-6-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]hexa-2,4-dien-3-yl]-4,6-diphenylpyridine (PubChem CID 135247145) has the molecular formula C59H42F2N2 and a molecular weight of 817.00 g/mol. Its IUPAC name is 2-[(2E,4Z)-6-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]hexa-2,4-dien-3-yl]-4,6-diphenylpyridine.
| Compound Name | 2-[(2E,4Z)-6-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]hexa-2,4-dien-3-yl]-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 135247145 |
| Molecular Formula | C59H42F2N2 |
| Molecular Weight | 817.00 g/mol |
| Exact Mass | 816.33 |
| IUPAC Name | 2-[(2E,4Z)-6-[6-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-difluorofluoren-3-yl]hexa-2,4-dien-3-yl]-4,6-diphenylpyridine |
| SMILES | C/C=C(\C=C/Cc1ccc2c(c1)-c1cc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)cc3)ccc1C2(F)F)c1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C59H42F2N2/c1-2-41(55-36-49(42-17-7-3-8-18-42)37-56(62-55)45-19-9-4-10-20-45)25-15-16-40-26-32-53-51(34-40)52-35-48(31-33-54(52)59(53,60)61)43-27-29-44(30-28-43)50-38-57(46-21-11-5-12-22-46)63-58(39-50)47-23-13-6-14-24-47/h2-15,17-39H,16H2,1H3/b25-15-,41-2+ |
| InChIKey | OYDGKUQQKRWIBO-YQMSFGHOSA-N |
| XLogP | 15.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.00 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|