C24H22ClN — CID 144989357
4-(4-chlorophenyl)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]-6-phenylpyridine (PubChem CID 144989357) has the molecular formula C24H22ClN and a molecular weight of 359.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]-6-phenylpyridine.
| Compound Name | 4-(4-chlorophenyl)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]-6-phenylpyridine |
|---|---|
| PubChem CID | 144989357 |
| Molecular Formula | C24H22ClN |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]-6-phenylpyridine |
| SMILES | C/C=C(\C=C(C)C)c1cc(-c2ccc(Cl)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H22ClN/c1-4-18(14-17(2)3)23-15-21(19-10-12-22(25)13-11-19)16-24(26-23)20-8-6-5-7-9-20/h4-16H,1-3H3/b18-4+ |
| InChIKey | URQDSBPLJZCKHK-JJPRUIFNSA-N |
| XLogP | 7.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|