C55H40N4 — CID 146480662
6-[2-[4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline (PubChem CID 146480662) has the molecular formula C55H40N4 and a molecular weight of 756.95 g/mol. Its IUPAC name is 6-[2-[4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline.
| Compound Name | 6-[2-[4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 146480662 |
| Molecular Formula | C55H40N4 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.33 |
| IUPAC Name | 6-[2-[4-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccc(-c3ccccc3)cc2)cc(-c2ccc(-c3ccccc3-c3nc4ccccc4c4c5ccccc5n(-c5ccccc5)c34)cc2)n1 |
| InChI | InChI=1S/C55H40N4/c1-3-17-37(4-2)55-57-49(41-32-28-39(29-33-41)38-18-7-5-8-19-38)36-50(58-55)42-34-30-40(31-35-42)44-22-11-12-23-45(44)53-54-52(46-24-13-15-26-48(46)56-53)47-25-14-16-27-51(47)59(54)43-20-9-6-10-21-43/h3-36H,1-2H3/b17-3-,37-4+ |
| InChIKey | JUEYUKZWBGXNFP-CVAPFLOTSA-N |
| XLogP | 14.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|