C60H39N5 — CID 156551653
6-[4-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline (PubChem CID 156551653) has the molecular formula C60H39N5 and a molecular weight of 830.01 g/mol. Its IUPAC name is 6-[4-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline.
| Compound Name | 6-[4-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 156551653 |
| Molecular Formula | C60H39N5 |
| Molecular Weight | 830.01 g/mol |
| Exact Mass | 829.32 |
| IUPAC Name | 6-[4-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-7-phenylindolo[2,3-c]quinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccc(-c6nc7ccccc7c7c8ccccc8n(-c8ccccc8)c67)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C60H39N5/c1-4-14-40(15-5-1)42-26-34-47(35-27-42)58-62-59(48-36-28-43(29-37-48)41-16-6-2-7-17-41)64-60(63-58)49-38-30-45(31-39-49)44-24-32-46(33-25-44)56-57-55(51-20-10-12-22-53(51)61-56)52-21-11-13-23-54(52)65(57)50-18-8-3-9-19-50/h1-39H |
| InChIKey | LIQHYIAFCXLVKT-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.01 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |