C50H32N6 — CID 170064411
11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,20-diphenyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (PubChem CID 170064411) has the molecular formula C50H32N6 and a molecular weight of 716.85 g/mol. Its IUPAC name is 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,20-diphenyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene.
| Compound Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,20-diphenyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 170064411 |
| Molecular Formula | C50H32N6 |
| Molecular Weight | 716.85 g/mol |
| Exact Mass | 716.27 |
| IUPAC Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,20-diphenyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc5c6ccccc6n(-c6ccccc6)c5c5c6ccccc6n(-c6ccccc6)c45)cc3)n2)cc1 |
| InChI | InChI=1S/C50H32N6/c1-5-17-34(18-6-1)48-52-49(35-19-7-2-8-20-35)54-50(53-48)36-31-29-33(30-32-36)44-46-43(39-25-13-15-27-41(39)55(46)37-21-9-3-10-22-37)47-45(51-44)40-26-14-16-28-42(40)56(47)38-23-11-4-12-24-38/h1-32H |
| InChIKey | NWSSHWKDPITSLN-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.85 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |