C25H26F3N3 — CID 144615931
ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[3-methyl-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 144615931) has the molecular formula C25H26F3N3 and a molecular weight of 425.50 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[3-methyl-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[3-methyl-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 144615931 |
| Molecular Formula | C25H26F3N3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[3-methyl-5-(trifluoromethyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2cc(C)cc(C(F)(F)F)c2)n1.CC |
| InChI | InChI=1S/C23H20F3N3.C2H6/c1-4-9-16(5-2)20-27-21(17-10-7-6-8-11-17)29-22(28-20)18-12-15(3)13-19(14-18)23(24,25)26;1-2/h4-14H,1-3H3;1-2H3/b9-4-,16-5+; |
| InChIKey | PLBACTVUNACWSE-FXBAXAPZSA-N |
| XLogP | 7.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|