C25H27N — CID 145357948
2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylpyridine (PubChem CID 145357948) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylpyridine.
| Compound Name | 2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylpyridine |
|---|---|
| PubChem CID | 145357948 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylpyridine |
| SMILES | C=C/C=C\C(=C/C)c1ccc(-c2cc(C(/C=C\C)=C/C)cc(C)n2)cc1 |
| InChI | InChI=1S/C25H27N/c1-6-10-12-21(9-4)22-13-15-23(16-14-22)25-18-24(17-19(5)26-25)20(8-3)11-7-2/h6-18H,1H2,2-5H3/b11-7-,12-10-,20-8+,21-9+ |
| InChIKey | ZZKJLLUXSHOYHR-KYWUBUAXSA-N |
| XLogP | 7.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|