C13H13Br — CID 144639814
1-bromo-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene (PubChem CID 144639814) has the molecular formula C13H13Br and a molecular weight of 249.15 g/mol. Its IUPAC name is 1-bromo-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene.
| Compound Name | 1-bromo-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 144639814 |
| Molecular Formula | C13H13Br |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1-bromo-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene |
| SMILES | C=C/C=C\C(=C/C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13Br/c1-3-5-6-11(4-2)12-7-9-13(14)10-8-12/h3-10H,1H2,2H3/b6-5-,11-4+ |
| InChIKey | OLDDFXZUTNHYIN-VWXLBWAMSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|