C25H19BrO — CID 121449415
4-(4-bromophenyl)-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran (PubChem CID 121449415) has the molecular formula C25H19BrO and a molecular weight of 415.33 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran.
| Compound Name | 4-(4-bromophenyl)-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran |
|---|---|
| PubChem CID | 121449415 |
| Molecular Formula | C25H19BrO |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 4-(4-bromophenyl)-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran |
| SMILES | C=C/C=C\C(=C/C)c1cccc2c1oc1c(-c3ccc(Br)cc3)cccc12 |
| InChI | InChI=1S/C25H19BrO/c1-3-5-8-17(4-2)20-9-6-11-22-23-12-7-10-21(25(23)27-24(20)22)18-13-15-19(26)16-14-18/h3-16H,1H2,2H3/b8-5-,17-4+ |
| InChIKey | SINKWBYRSBZZEY-LHUXLXAWSA-N |
| XLogP | 8.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|