About 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran
4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran (PubChem CID 158212345) has the molecular formula C36H23BrO2
and a molecular weight of 567.48 g/mol. Its IUPAC name is 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran.
Molecular Properties
| Compound Name | 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran |
| PubChem CID | 158212345 |
| Molecular Formula | C36H23BrO2 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran |
| SMILES | Brc1cccc2c1oc1c(-c3ccccc3)cccc12.c1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C18H11BrO.C18H12O/c19-16-11-5-10-15-14-9-4-8-13(17(14)20-18(15)16)12-6-2-1-3-7-12;1-2-7-13(8-3-1)14-10-6-11-16-15-9-4-5-12-17(15)19-18(14)16/h1-11H;1-12H |
| InChIKey | GCFQEXVRYZZDNC-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran?
The IUPAC name of 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran (CID 158212345) is 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran.
What is the SMILES notation for 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran?
The canonical SMILES for 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran is Brc1cccc2c1oc1c(-c3ccccc3)cccc12.c1ccc(-c2cccc3c2oc2ccccc23)cc1.
What is the InChIKey of 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran?
The InChIKey is GCFQEXVRYZZDNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrO.C18H12O/c19-16-11-5-10-15-14-9-4-8-13(17(14)20-18(15)16)12-6-2-1-3-7-12;1-2-7-13(8-3-1)14-10-6-11-16-15-9-4-5-12-17(15)19-18(14)16/h1-11H;1-12H.
What are the key properties of 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran?
4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran has a molecular weight of 567.48 g/mol, XLogP of 11.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-phenyldibenzofuran;4-phenyldibenzofuran is sourced from PubChem (CID 158212345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).