About 4-bromodibenzofuran;4-phenylaniline
4-bromodibenzofuran;4-phenylaniline (PubChem CID 122673561) has the molecular formula C24H18BrNO
and a molecular weight of 416.32 g/mol. Its IUPAC name is 4-bromodibenzofuran;4-phenylaniline.
Molecular Properties
| Compound Name | 4-bromodibenzofuran;4-phenylaniline |
| PubChem CID | 122673561 |
| Molecular Formula | C24H18BrNO |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 4-bromodibenzofuran;4-phenylaniline |
| SMILES | Brc1cccc2c1oc1ccccc12.Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H7BrO.C12H11N/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-7H;1-9H,13H2 |
| InChIKey | JMOZMLVEQFMKSW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromodibenzofuran;4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromodibenzofuran;4-phenylaniline?
The IUPAC name of 4-bromodibenzofuran;4-phenylaniline (CID 122673561) is 4-bromodibenzofuran;4-phenylaniline.
What is the SMILES notation for 4-bromodibenzofuran;4-phenylaniline?
The canonical SMILES for 4-bromodibenzofuran;4-phenylaniline is Brc1cccc2c1oc1ccccc12.Nc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-bromodibenzofuran;4-phenylaniline?
The InChIKey is JMOZMLVEQFMKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrO.C12H11N/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-7H;1-9H,13H2.
What are the key properties of 4-bromodibenzofuran;4-phenylaniline?
4-bromodibenzofuran;4-phenylaniline has a molecular weight of 416.32 g/mol, XLogP of 7.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromodibenzofuran;4-phenylaniline is sourced from PubChem (CID 122673561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).