C24H19NO — CID 144554378
1,1'-biphenyl;dibenzofuran-4-amine (PubChem CID 144554378) has the molecular formula C24H19NO and a molecular weight of 337.42 g/mol. Its IUPAC name is 1,1'-biphenyl;dibenzofuran-4-amine.
| Compound Name | 1,1'-biphenyl;dibenzofuran-4-amine |
|---|---|
| PubChem CID | 144554378 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1,1'-biphenyl;dibenzofuran-4-amine |
| SMILES | Nc1cccc2c1oc1ccccc12.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9NO.C12H10/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-7H,13H2;1-10H |
| InChIKey | VFSSPOSSLTUCRE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|