C30H21NO — CID 177127768
2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline (PubChem CID 177127768) has the molecular formula C30H21NO and a molecular weight of 419.55 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline |
|---|---|
| PubChem CID | 177127768 |
| Molecular Formula | C30H21NO |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(-c2ccccc2)c([2H])c([2H])c1Nc1c([2H])c([2H])c(-c2cccc3c2oc2ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C30H21NO/c1-2-7-21(8-3-1)22-13-17-24(18-14-22)31-25-19-15-23(16-20-25)26-10-6-11-28-27-9-4-5-12-29(27)32-30(26)28/h1-20,31H/i13D,14D,15D,16D,17D,18D,19D,20D |
| InChIKey | QLVJMUILAGEUOP-WRDZJLSDSA-N |
| XLogP | 8.66 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |