C61H41NO — CID 171452548
9,9-diphenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 171452548) has the molecular formula C61H41NO and a molecular weight of 812.05 g/mol. Its IUPAC name is 9,9-diphenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-diphenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 171452548 |
| Molecular Formula | C61H41NO |
| Molecular Weight | 812.05 g/mol |
| Exact Mass | 811.37 |
| IUPAC Name | 9,9-diphenyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4c3oc3ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C61H41NO/c1-4-15-42(16-5-1)43-27-29-44(30-28-43)45-31-35-49(36-32-45)62(50-37-33-46(34-38-50)52-23-14-24-56-55-22-11-13-26-59(55)63-60(52)56)51-39-40-54-53-21-10-12-25-57(53)61(58(54)41-51,47-17-6-2-7-18-47)48-19-8-3-9-20-48/h1-41H/i31D,32D,33D,34D,35D,36D,37D,38D |
| InChIKey | PJZLPWZVYRFFPZ-JPVWWJKOSA-N |
| XLogP | 16.42 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.05 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |