C55H37NO — CID 171452110
9,9-diphenyl-N-(2-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)fluoren-2-amine (PubChem CID 171452110) has the molecular formula C55H37NO and a molecular weight of 731.93 g/mol. Its IUPAC name is 9,9-diphenyl-N-(2-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)fluoren-2-amine.
| Compound Name | 9,9-diphenyl-N-(2-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171452110 |
| Molecular Formula | C55H37NO |
| Molecular Weight | 731.93 g/mol |
| Exact Mass | 731.31 |
| IUPAC Name | 9,9-diphenyl-N-(2-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c2ccccc2-c2ccccc2)c([2H])c([2H])c1-c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C55H37NO/c1-4-17-38(18-5-1)44-23-11-14-29-52(44)56(42-33-31-39(32-34-42)45-26-16-27-49-48-25-12-15-30-53(48)57-54(45)49)43-35-36-47-46-24-10-13-28-50(46)55(51(47)37-43,40-19-6-2-7-20-40)41-21-8-3-9-22-41/h1-37H/i31D,32D,33D,34D |
| InChIKey | IXGTWZSHIFDGLJ-FQFBMFJUSA-N |
| XLogP | 14.75 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.93 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |