C26H22S — CID 144687861
4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-methylphenyl)dibenzothiophene (PubChem CID 144687861) has the molecular formula C26H22S and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-methylphenyl)dibenzothiophene.
| Compound Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-methylphenyl)dibenzothiophene |
|---|---|
| PubChem CID | 144687861 |
| Molecular Formula | C26H22S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-methylphenyl)dibenzothiophene |
| SMILES | C=C/C=C\C(=C/C)c1cccc2c1sc1c(-c3ccc(C)cc3)cccc12 |
| InChI | InChI=1S/C26H22S/c1-4-6-9-19(5-2)21-10-7-12-23-24-13-8-11-22(26(24)27-25(21)23)20-16-14-18(3)15-17-20/h4-17H,1H2,2-3H3/b9-6-,19-5+ |
| InChIKey | AKNWQWUIZJXVHP-RRUPQTTLSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|