About 4-(4-methylphenyl)dibenzothiophene;methylphosphane
4-(4-methylphenyl)dibenzothiophene;methylphosphane (PubChem CID 142353145) has the molecular formula C20H19PS
and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(4-methylphenyl)dibenzothiophene;methylphosphane.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)dibenzothiophene;methylphosphane |
| PubChem CID | 142353145 |
| Molecular Formula | C20H19PS |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-(4-methylphenyl)dibenzothiophene;methylphosphane |
| SMILES | CP.Cc1ccc(-c2cccc3c2sc2ccccc23)cc1 |
| InChI | InChI=1S/C19H14S.CH5P/c1-13-9-11-14(12-10-13)15-6-4-7-17-16-5-2-3-8-18(16)20-19(15)17;1-2/h2-12H,1H3;2H2,1H3 |
| InChIKey | OYUVJFGQGAOYHB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)dibenzothiophene;methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)dibenzothiophene;methylphosphane?
The IUPAC name of 4-(4-methylphenyl)dibenzothiophene;methylphosphane (CID 142353145) is 4-(4-methylphenyl)dibenzothiophene;methylphosphane.
What is the SMILES notation for 4-(4-methylphenyl)dibenzothiophene;methylphosphane?
The canonical SMILES for 4-(4-methylphenyl)dibenzothiophene;methylphosphane is CP.Cc1ccc(-c2cccc3c2sc2ccccc23)cc1.
What is the InChIKey of 4-(4-methylphenyl)dibenzothiophene;methylphosphane?
The InChIKey is OYUVJFGQGAOYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14S.CH5P/c1-13-9-11-14(12-10-13)15-6-4-7-17-16-5-2-3-8-18(16)20-19(15)17;1-2/h2-12H,1H3;2H2,1H3.
What are the key properties of 4-(4-methylphenyl)dibenzothiophene;methylphosphane?
4-(4-methylphenyl)dibenzothiophene;methylphosphane has a molecular weight of 322.41 g/mol, XLogP of 6.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)dibenzothiophene;methylphosphane is sourced from PubChem (CID 142353145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).