C19H14OS — CID 138456987
4-(4-methoxyphenyl)dibenzothiophene (PubChem CID 138456987) has the molecular formula C19H14OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)dibenzothiophene.
| Compound Name | 4-(4-methoxyphenyl)dibenzothiophene |
|---|---|
| PubChem CID | 138456987 |
| Molecular Formula | C19H14OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-(4-methoxyphenyl)dibenzothiophene |
| SMILES | COc1ccc(-c2cccc3c2sc2ccccc23)cc1 |
| InChI | InChI=1S/C19H14OS/c1-20-14-11-9-13(10-12-14)15-6-4-7-17-16-5-2-3-8-18(16)21-19(15)17/h2-12H,1H3 |
| InChIKey | SHWHQQRNZFTTIQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |