C25H21NS — CID 90135832
(2E,4Z)-6-(6-phenyldibenzothiophen-4-yl)hepta-2,4,6-trien-3-amine (PubChem CID 90135832) has the molecular formula C25H21NS and a molecular weight of 367.52 g/mol. Its IUPAC name is (2E,4Z)-6-(6-phenyldibenzothiophen-4-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-(6-phenyldibenzothiophen-4-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 90135832 |
| Molecular Formula | C25H21NS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2E,4Z)-6-(6-phenyldibenzothiophen-4-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C)c1cccc2c1sc1c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C25H21NS/c1-3-19(26)16-15-17(2)20-11-7-13-22-23-14-8-12-21(25(23)27-24(20)22)18-9-5-4-6-10-18/h3-16H,2,26H2,1H3/b16-15-,19-3+ |
| InChIKey | NRWSWIXEQHDBQK-VKEAPAOJSA-N |
| XLogP | 7.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|