C55H39N3S — CID 142425240
buta-1,3-diene;2-(4-dibenzothiophen-4-ylphenyl)-4-phenyl-6-[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 142425240) has the molecular formula C55H39N3S and a molecular weight of 774.01 g/mol. Its IUPAC name is buta-1,3-diene;2-(4-dibenzothiophen-4-ylphenyl)-4-phenyl-6-[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | buta-1,3-diene;2-(4-dibenzothiophen-4-ylphenyl)-4-phenyl-6-[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 142425240 |
| Molecular Formula | C55H39N3S |
| Molecular Weight | 774.01 g/mol |
| Exact Mass | 773.29 |
| IUPAC Name | buta-1,3-diene;2-(4-dibenzothiophen-4-ylphenyl)-4-phenyl-6-[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | C=CC=C.c1ccc(-c2ccc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc(-c7cccc8c7sc7ccccc78)cc6)n5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C51H33N3S.C4H6/c1-3-10-34(11-4-1)35-18-20-36(21-19-35)37-22-24-38(25-23-37)39-26-30-42(31-27-39)50-52-49(41-12-5-2-6-13-41)53-51(54-50)43-32-28-40(29-33-43)44-15-9-16-46-45-14-7-8-17-47(45)55-48(44)46;1-3-4-2/h1-33H;3-4H,1-2H2 |
| InChIKey | NQAUZCHZOSFFTP-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.01 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|