C39H25N3S — CID 168831660
2-dibenzothiophen-4-yl-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 168831660) has the molecular formula C39H25N3S and a molecular weight of 567.72 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-4-yl-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168831660 |
| Molecular Formula | C39H25N3S |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 2-dibenzothiophen-4-yl-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5cccc6c5sc5ccccc56)n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H25N3S/c1-3-10-26(11-4-1)27-18-20-28(21-19-27)29-22-24-31(25-23-29)38-40-37(30-12-5-2-6-13-30)41-39(42-38)34-16-9-15-33-32-14-7-8-17-35(32)43-36(33)34/h1-25H |
| InChIKey | BBENMNPHPGTSPI-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |