C21H12ClN3S — CID 118539812
2-chloro-4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazine (PubChem CID 118539812) has the molecular formula C21H12ClN3S and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-chloro-4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118539812 |
| Molecular Formula | C21H12ClN3S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-chloro-4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2cccc3c2sc2ccccc23)n1 |
| InChI | InChI=1S/C21H12ClN3S/c22-21-24-19(13-7-2-1-3-8-13)23-20(25-21)16-11-6-10-15-14-9-4-5-12-17(14)26-18(15)16/h1-12H |
| InChIKey | SKNADSBKOSKSNG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |