C19H17FO2 — CID 143981962
[2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-6-hydroxyphenyl] hypofluorite (PubChem CID 143981962) has the molecular formula C19H17FO2 and a molecular weight of 296.34 g/mol. Its IUPAC name is [2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-6-hydroxyphenyl] hypofluorite.
| Compound Name | [2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-6-hydroxyphenyl] hypofluorite |
|---|---|
| PubChem CID | 143981962 |
| Molecular Formula | C19H17FO2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-6-hydroxyphenyl] hypofluorite |
| SMILES | C=C/C=C\C(=C/C)c1ccccc1-c1cccc(O)c1OF |
| InChI | InChI=1S/C19H17FO2/c1-3-5-9-14(4-2)15-10-6-7-11-16(15)17-12-8-13-18(21)19(17)22-20/h3-13,21H,1H2,2H3/b9-5-,14-4+ |
| InChIKey | XWXPGKWYGMKSPA-BANWFZCWSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|