C19H21N — CID 145274973
(3Z,5E)-5-(2-phenylphenyl)hepta-3,5-dien-2-amine (PubChem CID 145274973) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is (3Z,5E)-5-(2-phenylphenyl)hepta-3,5-dien-2-amine.
| Compound Name | (3Z,5E)-5-(2-phenylphenyl)hepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 145274973 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3Z,5E)-5-(2-phenylphenyl)hepta-3,5-dien-2-amine |
| SMILES | C/C=C(\C=C/C(C)N)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H21N/c1-3-16(14-13-15(2)20)18-11-7-8-12-19(18)17-9-5-4-6-10-17/h3-15H,20H2,1-2H3/b14-13-,16-3+ |
| InChIKey | YKIAFOAPYSUNMU-ZVBUOUDBSA-N |
| XLogP | 4.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|