About boric acid;1-(2-phenylphenyl)ethanamine
boric acid;1-(2-phenylphenyl)ethanamine (PubChem CID 175210638) has the molecular formula C14H18BNO3
and a molecular weight of 259.11 g/mol. Its IUPAC name is boric acid;1-(2-phenylphenyl)ethanamine.
Molecular Properties
| Compound Name | boric acid;1-(2-phenylphenyl)ethanamine |
| PubChem CID | 175210638 |
| Molecular Formula | C14H18BNO3 |
| Molecular Weight | 259.11 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | boric acid;1-(2-phenylphenyl)ethanamine |
| SMILES | CC(N)c1ccccc1-c1ccccc1.OB(O)O |
| InChI | InChI=1S/C14H15N.BH3O3/c1-11(15)13-9-5-6-10-14(13)12-7-3-2-4-8-12;2-1(3)4/h2-11H,15H2,1H3;2-4H |
| InChIKey | DMBJWSRKURZLDG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.11 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;1-(2-phenylphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;1-(2-phenylphenyl)ethanamine?
The IUPAC name of boric acid;1-(2-phenylphenyl)ethanamine (CID 175210638) is boric acid;1-(2-phenylphenyl)ethanamine.
What is the SMILES notation for boric acid;1-(2-phenylphenyl)ethanamine?
The canonical SMILES for boric acid;1-(2-phenylphenyl)ethanamine is CC(N)c1ccccc1-c1ccccc1.OB(O)O.
What is the InChIKey of boric acid;1-(2-phenylphenyl)ethanamine?
The InChIKey is DMBJWSRKURZLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.BH3O3/c1-11(15)13-9-5-6-10-14(13)12-7-3-2-4-8-12;2-1(3)4/h2-11H,15H2,1H3;2-4H.
What are the key properties of boric acid;1-(2-phenylphenyl)ethanamine?
boric acid;1-(2-phenylphenyl)ethanamine has a molecular weight of 259.11 g/mol, XLogP of 1.32, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;1-(2-phenylphenyl)ethanamine is sourced from PubChem (CID 175210638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).