C39H34O2 — CID 70214547
bis(1,1'-biphenyl);2-(2-phenylphenyl)propanoic acid (PubChem CID 70214547) has the molecular formula C39H34O2 and a molecular weight of 534.70 g/mol. Its IUPAC name is bis(1,1'-biphenyl);2-(2-phenylphenyl)propanoic acid.
| Compound Name | bis(1,1'-biphenyl);2-(2-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 70214547 |
| Molecular Formula | C39H34O2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | bis(1,1'-biphenyl);2-(2-phenylphenyl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccccc1-c1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14O2.2C12H10/c1-11(15(16)17)13-9-5-6-10-14(13)12-7-3-2-4-8-12;2*1-3-7-11(8-4-1)12-9-5-2-6-10-12/h2-11H,1H3,(H,16,17);2*1-10H |
| InChIKey | VCPKQFMIXNCZEO-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |