2-(2-phenylphenyl)pentanoic acid

C17H18O2 — CID 67565626

IUPAC2-(2-phenylphenyl)pentanoic acid
SMILESCCCC(C(=O)O)c1ccccc1-c1ccccc1
InChIInChI=1S/C17H18O2/c1-2-8-16(17(18)19)15-12-7-6-11-14(15)13-9-4-3-5-10-13/h3-7,9-12,16H,2,8H2,1H3,(H,18,19)
InChIKeySPUFEYXJGQOPAD-UHFFFAOYSA-N
MW254.33 g/mol
LogP4.32
Rot. Bonds5

About 2-(2-phenylphenyl)pentanoic acid

2-(2-phenylphenyl)pentanoic acid (PubChem CID 67565626) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(2-phenylphenyl)pentanoic acid.

Molecular Properties

Compound Name2-(2-phenylphenyl)pentanoic acid
PubChem CID67565626
Molecular FormulaC17H18O2
Molecular Weight254.33 g/mol
Exact Mass254.13
IUPAC Name2-(2-phenylphenyl)pentanoic acid
SMILESCCCC(C(=O)O)c1ccccc1-c1ccccc1
InChIInChI=1S/C17H18O2/c1-2-8-16(17(18)19)15-12-7-6-11-14(15)13-9-4-3-5-10-13/h3-7,9-12,16H,2,8H2,1H3,(H,18,19)
InChIKeySPUFEYXJGQOPAD-UHFFFAOYSA-N
XLogP4.32
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.33
LogP ≤ 54.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2-phenylphenyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(1-carboxybutyl)benzoic acid
CID 51041232
2-(2-phenylanilino)pentanoic acid
CID 83037413
2-(2,3-diamino-6-phenylphenyl)pentanoic acid
CID 57185698
2-[2-(diaminomethylideneamino)phenyl]pentanoic acid
CID 174893265
bis(1,1'-biphenyl);2-(2-phenylphenyl)propanoic acid
CID 70214547
2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid
CID 151443637
ethyl (2R)-2-chloro-2-(2-phenylphenyl)acetate
CID 124634186
2-[2-(trifluoromethylsulfonyl)phenyl]pentanoic acid
CID 104571902
2-[2-(4-carboxybutyl)phenyl]pentanoic acid
CID 139936646
4-(dimethylamino)-2-(2-phenylphenyl)butanamide
CID 70546597
2-[2-(4-aminophenyl)anilino]pentanoic acid
CID 22051506
5-(diethylamino)-2-(2-phenylphenyl)pentanamide
CID 23453800

Frequently Asked Questions

What is the IUPAC name of 2-(2-phenylphenyl)pentanoic acid?
The IUPAC name of 2-(2-phenylphenyl)pentanoic acid (CID 67565626) is 2-(2-phenylphenyl)pentanoic acid.
What is the SMILES notation for 2-(2-phenylphenyl)pentanoic acid?
The canonical SMILES for 2-(2-phenylphenyl)pentanoic acid is CCCC(C(=O)O)c1ccccc1-c1ccccc1.
What is the InChIKey of 2-(2-phenylphenyl)pentanoic acid?
The InChIKey is SPUFEYXJGQOPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c1-2-8-16(17(18)19)15-12-7-6-11-14(15)13-9-4-3-5-10-13/h3-7,9-12,16H,2,8H2,1H3,(H,18,19).
What are the key properties of 2-(2-phenylphenyl)pentanoic acid?
2-(2-phenylphenyl)pentanoic acid has a molecular weight of 254.33 g/mol, XLogP of 4.32, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylphenyl)pentanoic acid is sourced from PubChem (CID 67565626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).