C24H26O4 — CID 151443637
2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid (PubChem CID 151443637) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid.
| Compound Name | 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid |
|---|---|
| PubChem CID | 151443637 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c2ccccc2c(C(CCC)C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C24H26O4/c1-3-9-19(23(25)26)21-15-11-5-7-13-17(15)22(20(10-4-2)24(27)28)18-14-8-6-12-16(18)21/h5-8,11-14,19-20H,3-4,9-10H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | PFAQIDGUCJZTOH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|