2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid

C24H26O4 — CID 151443637

IUPAC2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid
SMILESCCCC(C(=O)O)c1c2ccccc2c(C(CCC)C(=O)O)c2ccccc12
InChIInChI=1S/C24H26O4/c1-3-9-19(23(25)26)21-15-11-5-7-13-17(15)22(20(10-4-2)24(27)28)18-14-8-6-12-16(18)21/h5-8,11-14,19-20H,3-4,9-10H2,1-2H3,(H,25,26)(H,27,28)
InChIKeyPFAQIDGUCJZTOH-UHFFFAOYSA-N
MW378.47 g/mol
LogP5.93
Rot. Bonds8

About 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid

2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid (PubChem CID 151443637) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid.

Molecular Properties

Compound Name2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid
PubChem CID151443637
Molecular FormulaC24H26O4
Molecular Weight378.47 g/mol
Exact Mass378.18
IUPAC Name2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid
SMILESCCCC(C(=O)O)c1c2ccccc2c(C(CCC)C(=O)O)c2ccccc12
InChIInChI=1S/C24H26O4/c1-3-9-19(23(25)26)21-15-11-5-7-13-17(15)22(20(10-4-2)24(27)28)18-14-8-6-12-16(18)21/h5-8,11-14,19-20H,3-4,9-10H2,1-2H3,(H,25,26)(H,27,28)
InChIKeyPFAQIDGUCJZTOH-UHFFFAOYSA-N
XLogP5.93
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500378.47
LogP ≤ 55.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid?
The IUPAC name of 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid (CID 151443637) is 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid.
What is the SMILES notation for 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid?
The canonical SMILES for 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid is CCCC(C(=O)O)c1c2ccccc2c(C(CCC)C(=O)O)c2ccccc12.
What is the InChIKey of 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid?
The InChIKey is PFAQIDGUCJZTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O4/c1-3-9-19(23(25)26)21-15-11-5-7-13-17(15)22(20(10-4-2)24(27)28)18-14-8-6-12-16(18)21/h5-8,11-14,19-20H,3-4,9-10H2,1-2H3,(H,25,26)(H,27,28).
What are the key properties of 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid?
2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid has a molecular weight of 378.47 g/mol, XLogP of 5.93, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[10-(1-carboxybutyl)anthracen-9-yl]pentanoic acid is sourced from PubChem (CID 151443637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).