C17H22N2O2 — CID 67309970
2-[(7R)-7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]pentanoic acid (PubChem CID 67309970) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[(7R)-7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]pentanoic acid.
| Compound Name | 2-[(7R)-7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]pentanoic acid |
|---|---|
| PubChem CID | 67309970 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-[(7R)-7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c2n(c3ccccc13)C[C@H](N)CC2 |
| InChI | InChI=1S/C17H22N2O2/c1-2-5-13(17(20)21)16-12-6-3-4-7-14(12)19-10-11(18)8-9-15(16)19/h3-4,6-7,11,13H,2,5,8-10,18H2,1H3,(H,20,21)/t11-,13?/m1/s1 |
| InChIKey | MMSLFAUJBGCECC-JTDNENJMSA-N |
| XLogP | 2.88 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|